Information card for entry 2203219
| Chemical name |
N,N,N',N'-Tetrakis(2-pyridylmethyl)-1,2-diaminoethane |
| Formula |
C26 H28 N6 |
| Calculated formula |
C26 H28 N6 |
| SMILES |
c1ccc(nc1)CN(Cc1ccccn1)CCN(Cc1ccccn1)Cc1ccccn1 |
| Title of publication |
<i>N</i>,<i>N</i>,<i>N</i>',<i>N</i>'-Tetrakis(2-pyridylmethyl)-1,2-diaminoethane: a multidentate ligand |
| Authors of publication |
Fujihara, Takashi; Saito, Miki; Nagasawa, Akira |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
2 |
| Pages of publication |
o262 - o263 |
| a |
6.228 ± 0.001 Å |
| b |
9.482 ± 0.002 Å |
| c |
10.76 ± 0.002 Å |
| α |
77.66 ± 0.03° |
| β |
87.74 ± 0.03° |
| γ |
74.47 ± 0.03° |
| Cell volume |
598 ± 0.2 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0865 |
| Residual factor for significantly intense reflections |
0.0536 |
| Weighted residual factors for significantly intense reflections |
0.1247 |
| Weighted residual factors for all reflections included in the refinement |
0.1417 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.023 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203219.html
