Information card for entry 2203265
| Formula |
C6 H10 O3 S2 |
| Calculated formula |
C6 H10 O3 S2 |
| SMILES |
CC1=C(C)S(=O)(=O)CCS1(=O)=O |
| Title of publication |
2,3-Dihydro-5,6-dimethyl-1,4-dithiine 1,1,4-trioxide |
| Authors of publication |
Brewer, A. David; Ferguson, George; Lough, Alan J.; Strunk, Richard J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
3 |
| Pages of publication |
o392 - o394 |
| a |
5.5919 ± 0.0005 Å |
| b |
9.2507 ± 0.001 Å |
| c |
7.9146 ± 0.0009 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
409.41 ± 0.07 Å3 |
| Cell temperature |
150 ± 1 K |
| Ambient diffraction temperature |
150 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
18 |
| Hermann-Mauguin space group symbol |
P 21 21 2 |
| Hall space group symbol |
P 2 2ab |
| Residual factor for all reflections |
0.0674 |
| Residual factor for significantly intense reflections |
0.0562 |
| Weighted residual factors for significantly intense reflections |
0.1363 |
| Weighted residual factors for all reflections included in the refinement |
0.1432 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.159 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203265.html