Information card for entry 2203325
| Chemical name |
2,3-Dihydro-4-phenyl-1,4-benzoxazine-6,7-dicarbonitrile |
| Formula |
C16 H11 N3 O |
| Calculated formula |
C16 H11 N3 O |
| SMILES |
O1c2c(N(c3ccccc3)CC1)cc(c(c2)C#N)C#N |
| Title of publication |
2,3-Dihydro-4-phenyl-1,4-benzoxazine-6,7-dicarbonitrile |
| Authors of publication |
Karadayı, Nevzat; Akyüz, Emine; Kahveci, Bahittin; Ağar, Erbil; S̨aşmaz, Selami; Büyükgüngör, Orhan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
3 |
| Pages of publication |
o450 - o452 |
| a |
14.3699 ± 0.0014 Å |
| b |
7.5806 ± 0.0004 Å |
| c |
13.1208 ± 0.0014 Å |
| α |
90° |
| β |
114.879 ± 0.007° |
| γ |
90° |
| Cell volume |
1296.6 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0669 |
| Residual factor for significantly intense reflections |
0.0381 |
| Weighted residual factors for significantly intense reflections |
0.0893 |
| Weighted residual factors for all reflections included in the refinement |
0.0978 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.906 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203325.html