Information card for entry 2203409
| Chemical name |
Dimethyl 7-(N,N-dimethylamino)3-(4-methylbenzoyl)indolizine-1,2-dicarboxylate |
| Formula |
C22 H22 N2 O5 |
| Calculated formula |
C22 H22 N2 O5 |
| SMILES |
O=C(OC)c1c(c(n2ccc(N(C)C)cc12)C(=O)c1ccc(cc1)C)C(=O)OC |
| Title of publication |
Dimethyl 7-(<i>N</i>,<i>N</i>-dimethylamino)-3-(4-methylbenzoyl)indolizine-1,2-dicarboxylate |
| Authors of publication |
Hema, R.; Parthasarathi, V.; Ravikumar, K.; Sarkunam, K.; Nallu, M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
4 |
| Pages of publication |
o537 - o538 |
| a |
8.05 ± 0.005 Å |
| b |
16.942 ± 0.011 Å |
| c |
17.094 ± 0.011 Å |
| α |
118.555 ± 0.01° |
| β |
95.033 ± 0.012° |
| γ |
97.082 ± 0.011° |
| Cell volume |
2003 ± 2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0914 |
| Residual factor for significantly intense reflections |
0.0572 |
| Weighted residual factors for significantly intense reflections |
0.1367 |
| Weighted residual factors for all reflections included in the refinement |
0.1558 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.026 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203409.html