Information card for entry 2203456
| Chemical name |
cis-3-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carboxamide |
| Formula |
C18 H17 N3 O |
| Calculated formula |
C18 H17 N3 O |
| SMILES |
O=C(N1N=C2[C@@H]([C@@H]1c1ccccc1)CCc1ccccc21)N |
| Title of publication |
<i>cis</i>-3-Phenyl-3,3a,4,5-tetrahydrobenzo[<i>g</i>]indazole-2-carboxamide |
| Authors of publication |
Oloo, Eliud O.; Nienaber, Kurt; Quail, J. Wilson; Padmanilayam, Maniyan P.; Das, Umashankar; Dimmock, Jonathan R. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
4 |
| Pages of publication |
o610 - o612 |
| a |
7.902 ± 0.007 Å |
| b |
7.004 ± 0.005 Å |
| c |
13.736 ± 0.012 Å |
| α |
90° |
| β |
102.38 ± 0.08° |
| γ |
90° |
| Cell volume |
742.5 ± 1.1 Å3 |
| Cell temperature |
123 ± 2 K |
| Ambient diffraction temperature |
123 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0418 |
| Residual factor for significantly intense reflections |
0.0312 |
| Weighted residual factors for significantly intense reflections |
0.0769 |
| Weighted residual factors for all reflections included in the refinement |
0.0816 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.06 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203456.html