Information card for entry 2203475
| Chemical name |
4-(2,6-dichlorobenzylamino)-3-phenyl-5-p-tolyl-4H-1,2,4-triazole |
| Formula |
C22 H18 Cl2 N4 |
| Calculated formula |
C22 H18 Cl2 N4 |
| SMILES |
Clc1c(c(Cl)ccc1)CNn1c(nnc1c1ccc(cc1)C)c1ccccc1 |
| Title of publication |
4-(2,6-Dichlorobenzylamino)-3-phenyl-5-<i>p</i>-tolyl-4<i>H</i>-1,2,4-triazole |
| Authors of publication |
Dinçer, Muharrem; Özdemir, Namık; Bekircan, Olcay; Şaşmaz, Selami; Kolaylı, Sevgi; Karaoğlu, Şengül Alpay; Işık, Şamil |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
4 |
| Pages of publication |
o651 - o653 |
| a |
12.0008 ± 0.0011 Å |
| b |
27.4501 ± 0.0016 Å |
| c |
12.068 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3975.5 ± 1.1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.1642 |
| Residual factor for significantly intense reflections |
0.0517 |
| Weighted residual factors for significantly intense reflections |
0.0844 |
| Weighted residual factors for all reflections included in the refinement |
0.0937 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.006 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203475.html