Information card for entry 2203544
| Formula |
C11 H16 O4 S |
| Calculated formula |
C11 H16 O4 S |
| SMILES |
C1CC=C[C@H]2S(=O)(=O)C[C@@H](OC(=O)[C@@]12C)C.C1CC=C[C@@H]2S(=O)(=O)C[C@H](OC(=O)[C@]12C)C |
| Title of publication |
(4a<i>SR</i>,7<i>RS</i>,9a<i>SR</i>)-7,9a-Dimethyl-5,5-dioxo-1,2,4a,6,7,9a-hexahydro-8-oxa-5λ^6^-thia-1,4-benzocyclohepten-9-one |
| Authors of publication |
Zeller, Matthias; Hunter, Allen D.; Sampson, Paul; Chumachenko, Nataliya |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
5 |
| Pages of publication |
o729 - o730 |
| a |
10.0232 ± 0.001 Å |
| b |
10.6255 ± 0.001 Å |
| c |
11.6726 ± 0.0011 Å |
| α |
90° |
| β |
114.062 ± 0.002° |
| γ |
90° |
| Cell volume |
1135.13 ± 0.19 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0367 |
| Residual factor for significantly intense reflections |
0.0354 |
| Weighted residual factors for significantly intense reflections |
0.0954 |
| Weighted residual factors for all reflections included in the refinement |
0.0966 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.102 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203544.html