Information card for entry 2203586
| Chemical name |
1,2,3,5,6,7,8,9-Octachloro-cyclopenta[def]phenanthren-4-one |
| Formula |
C15 Cl8 O |
| Calculated formula |
C15 Cl8 O |
| SMILES |
Clc1c(Cl)c(Cl)c2c3c1c(Cl)c(Cl)c1c3c(c2=O)c(c(c1Cl)Cl)Cl |
| Title of publication |
1,2,3,5,6,7,8,9-Octachlorocyclopenta[<i>def</i>]phenanthren-4-one |
| Authors of publication |
Ying Peng; Su-Yuan Xie; Shun-Liu Deng; Rong-Bin Huang; Lan-Sun Zheng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
5 |
| Pages of publication |
o899 - o900 |
| a |
22.979 ± 0.005 Å |
| b |
8.718 ± 0.0017 Å |
| c |
15.697 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3144.6 ± 1.1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
64 |
| Hermann-Mauguin space group symbol |
C m c a |
| Hall space group symbol |
-C 2ac 2 |
| Residual factor for all reflections |
0.0849 |
| Residual factor for significantly intense reflections |
0.0498 |
| Weighted residual factors for significantly intense reflections |
0.0975 |
| Weighted residual factors for all reflections included in the refinement |
0.1099 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.042 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203586.html