Information card for entry 2203598
| Common name |
1,2-dimethyl-3-(2-nitrophenyl)-4,5-dihydroimidazolium iodide |
| Chemical name |
1,2-Dimethyl-3-(2-nitrophenyl)-4,5-dihydroimidazolium iodide |
| Formula |
C11 H14 I N3 O2 |
| Calculated formula |
C11 H14 I N3 O2 |
| SMILES |
[I-].O=N(=O)c1ccccc1N1CC[N+](=C1C)C |
| Title of publication |
1,2-Dimethyl-3-(2-nitrophenyl)-4,5-dihydroimidazolium iodide |
| Authors of publication |
Li, Dong-Hong; Hao, Jun-Sheng; Huo, Fang-Jun; Huang, Shu-Ping; Zhang, Yong-Bin; Xia, Chi-Zhong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
5 |
| Pages of publication |
o844 - o845 |
| a |
9.597 ± 0.002 Å |
| b |
10.09 ± 0.002 Å |
| c |
13.577 ± 0.003 Å |
| α |
90° |
| β |
94.187 ± 0.002° |
| γ |
90° |
| Cell volume |
1311.2 ± 0.5 Å3 |
| Cell temperature |
183 ± 2 K |
| Ambient diffraction temperature |
183 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0232 |
| Residual factor for significantly intense reflections |
0.0211 |
| Weighted residual factors for significantly intense reflections |
0.0529 |
| Weighted residual factors for all reflections included in the refinement |
0.0539 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.06 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203598.html