Information card for entry 2203648
| Chemical name |
(Acetato-κO)[N-(diacetyl monooxime)-N'-benzoylhydrazonato-κ^3^O,N,N'](1H-imidazole-κN^3^)zinc(II) |
| Formula |
C16 H19 N5 O4 Zn |
| Calculated formula |
C16 H19 N5 O4 Zn |
| SMILES |
[Zn]12([N](O)=C(C(=[N]1N=C(O2)c1ccccc1)C)C)([n]1c[nH]cc1)OC(=O)C |
| Title of publication |
(Acetato-κ<i>O</i>)[<i>N</i>-(diacetyl monooxime)-<i>N</i>'-benzoylhydrazonato-κ^3^<i>O</i>,<i>N</i>,<i>N</i>'](1<i>H</i>-imidazole-κ<i>N</i>^3^)zinc(II) |
| Authors of publication |
Huo, Li-Hua; Gao, Shan; Liu, Ji-Wei; Wang, Chong; Zhao, Jing-Gui |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
5 |
| Pages of publication |
m696 - m698 |
| a |
7.731 ± 0.002 Å |
| b |
18.334 ± 0.004 Å |
| c |
12.931 ± 0.003 Å |
| α |
90° |
| β |
100.07 ± 0.03° |
| γ |
90° |
| Cell volume |
1804.6 ± 0.8 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.047 |
| Residual factor for significantly intense reflections |
0.036 |
| Weighted residual factors for significantly intense reflections |
0.084 |
| Weighted residual factors for all reflections included in the refinement |
0.089 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.04 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203648.html