Information card for entry 2203687
| Common name |
Bis[(μ~2~-salicylato-O,O,O')(salicylato-O,O')] tetraimidazole-dicadmium |
| Chemical name |
Bis(μ-salicylato-κ^3^O,O':O')bis[(imidazole-κN^3^)(salicylato- κ^2^O,O')cadmium(II)] |
| Formula |
C40 H36 Cd2 N8 O12 |
| Calculated formula |
C40 H36 Cd2 N8 O12 |
| SMILES |
c1c(C2=[O][Cd]34([n]5c[nH]cc5)([n]5c[nH]cc5)(O2)[O]=C(c2c(O)cccc2)[O]3[Cd]23([n]5c[nH]cc5)([n]5c[nH]cc5)([O]=C(c5c(cccc5)O)O2)[O]=C(c2c(O)cccc2)[O]43)c(ccc1)O |
| Title of publication |
Bis(μ-salicylato-κ^3^<i>O</i>,<i>O</i>':<i>O</i>')bis[(imidazole-κ<i>N</i>^3^)(salicylato-κ^2^<i>O</i>,<i>O</i>')cadmium(II)] |
| Authors of publication |
Huo, Li-Hua; Gao, Shan; Gu, Chang-Sheng; Lu, Zhen-Zhong; Zhao, Hui; Zhao, Jing-Gui |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
5 |
| Pages of publication |
m596 - m598 |
| a |
9.339 ± 0.002 Å |
| b |
9.793 ± 0.002 Å |
| c |
12.251 ± 0.003 Å |
| α |
79.21 ± 0.03° |
| β |
86.28 ± 0.03° |
| γ |
69.76 ± 0.03° |
| Cell volume |
1032.7 ± 0.5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.032 |
| Residual factor for significantly intense reflections |
0.026 |
| Weighted residual factors for significantly intense reflections |
0.06 |
| Weighted residual factors for all reflections included in the refinement |
0.062 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.08 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203687.html