Information card for entry 2203699
| Chemical name |
Diaquabis(4,4'-bipyridine N,N'-dioxide-κO)bis(dicyanamido)cadmium(II) |
| Formula |
C24 H20 Cd N10 O6 |
| Calculated formula |
C24 H20 Cd N10 O6 |
| SMILES |
c1cn(ccc1c1ccn(cc1)=O)=[O][Cd](N=C=NC#N)([OH2])(N=C=NC#N)([O]=n1ccc(c2ccn(cc2)=O)cc1)[OH2] |
| Title of publication |
Diaquabis(4,4'-bipyridine <i>N,N</i>'-dioxide-κ<i>O</i>)bis(dicyanamido)cadmium(II) |
| Authors of publication |
Xu, Yanqing; Yuan, Daqiang; Xu, Ying; Bi, Wenhua; Zhou, Youfu; Hong, Maochun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
6 |
| Pages of publication |
m713 - m714 |
| a |
8.204 ± 0.0009 Å |
| b |
8.85 ± 0.001 Å |
| c |
9.667 ± 0.001 Å |
| α |
70.868 ± 0.001° |
| β |
79.068 ± 0.002° |
| γ |
73.184 ± 0.002° |
| Cell volume |
631.25 ± 0.12 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for significantly intense reflections |
0.0335 |
| Weighted residual factors for significantly intense reflections |
0.0789 |
| Weighted residual factors for all reflections included in the refinement |
0.0817 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.124 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203699.html