Information card for entry 2203706
| Chemical name |
Methoxy[3-methoxysalicylaldehyde (4-methoxybenzoyl)hydrazonato(2-)-κ^3^O,O',N]oxovanadium(V) |
| Formula |
C17 H17 N2 O6 V |
| Calculated formula |
C17 H17 N2 O6 V |
| SMILES |
[V]12([N](N=C(O2)c2ccc(OC)cc2)=Cc2c(O1)c(OC)ccc2)(=O)OC |
| Title of publication |
Methoxy[3-methoxysalicylaldehyde (4-methoxybenzoyl)hydrazonato(2–)-κ^3^<i>O</i>,<i>O</i>',<i>N</i>]oxovanadium(V) |
| Authors of publication |
Huo, Li-Hua; Gao, Shan; Liu, Ji-Wei; Li, Jing; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
6 |
| Pages of publication |
m758 - m760 |
| a |
7.531 ± 0.003 Å |
| b |
11.787 ± 0.004 Å |
| c |
19.786 ± 0.006 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1756.4 ± 1.1 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.04 |
| Residual factor for significantly intense reflections |
0.036 |
| Weighted residual factors for significantly intense reflections |
0.09 |
| Weighted residual factors for all reflections included in the refinement |
0.093 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203706.html