Information card for entry 2203727
| Chemical name |
trans-5,5'-[(2-Butene-1,4-diyl)dithio]bis(1-phenyl-1,2,3,4-tetrazole) |
| Formula |
C18 H16 N8 S2 |
| Calculated formula |
C18 H16 N8 S2 |
| SMILES |
S(c1n(nnn1)c1ccccc1)C/C=C/CSc1n(nnn1)c1ccccc1 |
| Title of publication |
<i>trans</i>-5,5'-[(2-Butene-1,4-diyl)dithio]bis(1-phenyl-1,2,3,4-tetrazole) |
| Authors of publication |
Wang, Wei; Liu, Hui-Min; Zhang, Wen-Qin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
6 |
| Pages of publication |
o1107 - o1109 |
| a |
9.727 ± 0.003 Å |
| b |
12.77 ± 0.004 Å |
| c |
15.947 ± 0.006 Å |
| α |
90° |
| β |
100.332 ± 0.006° |
| γ |
90° |
| Cell volume |
1948.7 ± 1.1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0814 |
| Residual factor for significantly intense reflections |
0.0406 |
| Weighted residual factors for significantly intense reflections |
0.0834 |
| Weighted residual factors for all reflections included in the refinement |
0.0974 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.006 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203727.html