Information card for entry 2203781
| Chemical name |
Bis-(5-amino-3-methyl-1-phenyl-1H-pyrazol-4-yl)-3,4,5-trimethoxyphenylmethane |
| Formula |
C30 H32 N6 O3 |
| Calculated formula |
C30 H32 N6 O3 |
| SMILES |
COc1cc(cc(c1OC)OC)C(c1c(C)nn(c1N)c1ccccc1)c1c(C)nn(c1N)c1ccccc1 |
| Title of publication |
Bis(5-amino-3-methyl-1-phenyl-1<i>H</i>-pyrazol-4-yl)-3,4,5-trimethoxyphenylmethane: sheets built from N—H···N and N—H···O hydrogen bonds |
| Authors of publication |
Low, John N.; Cobo, Justo; Portilla, Jaime; Quiroga, Jairo; Glidewell, Christopher |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
6 |
| Pages of publication |
o1034 - o1037 |
| a |
9.754 ± 0.0002 Å |
| b |
33.4646 ± 0.0007 Å |
| c |
8.901 ± 0.0001 Å |
| α |
90° |
| β |
103.602 ± 0.0009° |
| γ |
90° |
| Cell volume |
2823.92 ± 0.09 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0778 |
| Residual factor for significantly intense reflections |
0.0554 |
| Weighted residual factors for significantly intense reflections |
0.1314 |
| Weighted residual factors for all reflections included in the refinement |
0.1443 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.043 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203781.html