Information card for entry 2203829
| Formula |
C22 H15 Cl4 N4 O2 P3 |
| Calculated formula |
C22 H15 Cl4 N4 O2 P3 |
| SMILES |
ClP1(Cl)=NP2(=NP(Cl)(Cl)=N1)Oc1ccc3ccccc3c1C1Oc3ccc4ccccc4c3CN21 |
| Title of publication |
4,4,6,6-Tetrachloro-4a',8'-dihydrodinaphtho[2,1-<i>c</i>';2,1-<i>g</i>']-2λ^5^,4λ^5^,6λ^5^-cyclotriphosphazene-1-spiro-1'-[2,5,8a,1]dioxazaphosphanaphthalene |
| Authors of publication |
Tercan, Barış; Hökelek, Tuncer; Işıklan, Muhammed; İlter, Elif Ece; Kılıç, Zeynel |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
6 |
| Pages of publication |
o971 - o973 |
| a |
9.6154 ± 0.0007 Å |
| b |
11.5957 ± 0.001 Å |
| c |
13.1996 ± 0.0015 Å |
| α |
66.198 ± 0.008° |
| β |
74.053 ± 0.008° |
| γ |
67.858 ± 0.006° |
| Cell volume |
1234.1 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1032 |
| Residual factor for significantly intense reflections |
0.0504 |
| Weighted residual factors for significantly intense reflections |
0.1244 |
| Weighted residual factors for all reflections included in the refinement |
0.1482 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.987 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203829.html
