Information card for entry 2203875
| Chemical name |
Diacetato(5,5,7,12,12,14-hexamethyl-1,4,8,11-tetraazacyclotetradeca-1,8- diene)cobalt(III) triiodide |
| Formula |
C20 H38 Co I3 N4 O4 |
| Calculated formula |
C20 H38 Co I3 N4 O4 |
| SMILES |
O([Co]123([N]4=C(C)CC([NH]2CC[N]1=C(C)CC([NH]3CC4)(C)C)(C)C)OC(=O)C)C(=O)C.I[I-]I |
| Title of publication |
Diacetato(5,5,7,12,12,14-hexamethyl-1,4,8,11-tetraazacyclotetradeca-1,8-diene)cobalt(III) triiodide |
| Authors of publication |
Shu-Sheng Zhang; Shu-Yan Niu; Gui-Fen Jie; Xue-Mei Li; Kui Jiao |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
7 |
| Pages of publication |
m966 - m967 |
| a |
14.807 ± 0.003 Å |
| b |
9.7061 ± 0.0018 Å |
| c |
20.218 ± 0.004 Å |
| α |
90° |
| β |
98.589 ± 0.003° |
| γ |
90° |
| Cell volume |
2873.1 ± 1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0366 |
| Residual factor for significantly intense reflections |
0.0283 |
| Weighted residual factors for significantly intense reflections |
0.0676 |
| Weighted residual factors for all reflections included in the refinement |
0.0714 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203875.html