Information card for entry 2204053
| Chemical name |
(2E)-2-(2,4-Dichlorobenzylidene)-6,7-dihydro-2H-thiazolo[3,2-a]pyrimidin- 3(5H)-one |
| Formula |
C13 H10 Cl2 N2 O S |
| Calculated formula |
C13 H10 Cl2 N2 O S |
| SMILES |
S1C2=NCCCN2C(=O)/C1=C/c1ccc(Cl)cc1Cl |
| Title of publication |
(2E)-2-(2,4-Dichlorobenzylidene)-6,7-dihydro-2H-thiazolo[3,2-a]pyrimidin- 3(5H)-one |
| Authors of publication |
Liang, Zu-Pei; Cao, Chang-Qing |
| Journal of publication |
Acta Crystallographica, Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
8 |
| Pages of publication |
o1333 - o1334 |
| a |
6.155 ± 0.002 Å |
| b |
9.676 ± 0.004 Å |
| c |
22.507 ± 0.008 Å |
| α |
90° |
| β |
93.543 ± 0.006° |
| γ |
90° |
| Cell volume |
1337.8 ± 0.8 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0574 |
| Residual factor for significantly intense reflections |
0.0384 |
| Weighted residual factors for all reflections included in the refinement |
0.0944 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.062 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204053.html