Information card for entry 2204083
| Chemical name |
1-[2,6-Dichloro-4-(trifluoromethyl)phenyl]-5-(2,5-dioxo-2,5-dihydro-1H- pyrrol-1-yl)-1H-pyrazole-3-carbonitrile |
| Formula |
C15 H5 Cl2 F3 N4 O2 |
| Calculated formula |
C15 H5 Cl2 F3 N4 O2 |
| SMILES |
Clc1c(n2nc(cc2N2C(=O)C=CC2=O)C#N)c(Cl)cc(c1)C(F)(F)F |
| Title of publication |
1-[2,6-Dichloro-4-(trifluoromethyl)phenyl]-5-(2,5-dioxo-2,5-dihydro-1H- pyrrol-1-yl)-1H-pyrazole-3-carbonitrile |
| Authors of publication |
Yang, Zhiping; Zhong, Ping; Hu, Maolin |
| Journal of publication |
Acta Crystallographica, Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
8 |
| Pages of publication |
o1350 - o1351 |
| a |
12.8261 ± 0.001 Å |
| b |
8.9942 ± 0.0007 Å |
| c |
14.6896 ± 0.0012 Å |
| α |
90° |
| β |
104.217 ± 0.001° |
| γ |
90° |
| Cell volume |
1642.7 ± 0.2 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0652 |
| Residual factor for significantly intense reflections |
0.0552 |
| Weighted residual factors for significantly intense reflections |
0.1571 |
| Weighted residual factors for all reflections included in the refinement |
0.165 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.056 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204083.html