Information card for entry 2204126
| Chemical name |
(1α,2β,3α,6β)-3,6-Dichlorocyclohex-4-ene-1,2-diyl diacetate |
| Formula |
C10 H12 Cl2 O4 |
| Calculated formula |
C10 H12 Cl2 O4 |
| SMILES |
Cl[C@@H]1C=C[C@@H](Cl)[C@H](OC(=O)C)[C@H]1OC(=O)C |
| Title of publication |
(1α,2β,3α,6β)-3,6-Dichlorocyclohex-4-ene-1,2-diyl diacetate |
| Authors of publication |
Mehmet Akkurt; Sema Öztürk; Arif Baran; Hasan Seçen; Orhan Büyükgüngör |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
9 |
| Pages of publication |
o1453 - o1455 |
| a |
7.8525 ± 0.0007 Å |
| b |
7.8036 ± 0.0005 Å |
| c |
20.4482 ± 0.0012 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1253.02 ± 0.16 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0551 |
| Residual factor for significantly intense reflections |
0.0486 |
| Weighted residual factors for significantly intense reflections |
0.1385 |
| Weighted residual factors for all reflections included in the refinement |
0.1447 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204126.html