Information card for entry 2204224
| Chemical name |
2,2,5,5-Tetramethyl-1,6-diphenyl-7,8-diselenabicyclo[4.1.1]octane 7,8-dioxide |
| Formula |
C22 H26 O2 Se2 |
| Calculated formula |
C22 H26 O2 Se2 |
| SMILES |
[Se]1(=O)C2([Se](=O)C1(C(CCC2(C)C)(C)C)c1ccccc1)c1ccccc1 |
| Title of publication |
2,2,5,5-Tetramethyl-1,6-diphenyl-7,8-diselenabicyclo[4.1.1]octane 7,8-dioxide |
| Authors of publication |
Meng-Xin Ding; Bing Ma; Ran Zhu; Hai-Tao Sha; Ji Shao; Xin Sheng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
9 |
| Pages of publication |
o1458 - o1459 |
| a |
9.193 ± 0.0018 Å |
| b |
17.752 ± 0.004 Å |
| c |
12.779 ± 0.003 Å |
| α |
90° |
| β |
103.43 ± 0.03° |
| γ |
90° |
| Cell volume |
2028.4 ± 0.8 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0979 |
| Residual factor for significantly intense reflections |
0.0578 |
| Weighted residual factors for significantly intense reflections |
0.1941 |
| Weighted residual factors for all reflections included in the refinement |
0.2348 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.144 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204224.html