Information card for entry 2204313
| Chemical name |
3-(3-Hydroxypropyl)-6-(4-methylphenyl)-7H-1,2,4-triazolo [3,4-b][1,3,4]thiadiazine dihydrate |
| Formula |
C14 H20 N4 O3 S |
| Calculated formula |
C14 H20 N4 O3 S |
| SMILES |
S1CC(=Nn2c1nnc2CCCO)c1ccc(C)cc1.O.O |
| Title of publication |
3-(3-Hydroxypropyl)-6-(4-methylphenyl)-7H-1,2,4-triazolo- [3,4-b][1,3,4]thiadiazine dihydrate |
| Authors of publication |
Zou, Kai-Huang; Cai, Xiao-Qing; Chen, Jiu-Xi; Zhang, Li-Xue; Zhang, An-Jiang; Hu, Mao-Lin |
| Journal of publication |
Acta Crystallographica, Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
10 |
| Pages of publication |
m1736 - m1738 |
| a |
12.7018 ± 0.0012 Å |
| b |
7.3602 ± 0.0007 Å |
| c |
17.3967 ± 0.0017 Å |
| α |
90° |
| β |
92.612 ± 0.002° |
| γ |
90° |
| Cell volume |
1624.7 ± 0.3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.097 |
| Residual factor for significantly intense reflections |
0.0715 |
| Weighted residual factors for significantly intense reflections |
0.1453 |
| Weighted residual factors for all reflections included in the refinement |
0.157 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.146 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204313.html