Information card for entry 2204376
| Chemical name |
5-Benzyl-8-(E)-benzylidene-6,7,7a,10a-tetrahydro-5H-cis- cyclopenta[5,6]pyrano[3,3-c]quinolin-6-one |
| Formula |
C29 H23 N O2 |
| Calculated formula |
C29 H23 N O2 |
| SMILES |
n1(c2c(c3O[C@H]4[C@H](C(=C\c5ccccc5)\C=C4)Cc3c1=O)cccc2)Cc1ccccc1.n1(c2c(c3O[C@@H]4[C@@H](C(=C\c5ccccc5)\C=C4)Cc3c1=O)cccc2)Cc1ccccc1 |
| Title of publication |
5-Benzyl-8-(<i>E</i>)-benzylidene-6,7,7a,10a-tetrahydro-5<i>H</i>-<i>cis</i>-cyclopenta[5,6]pyrano[3,3-<i>c</i>]quinolin-6-one |
| Authors of publication |
S.Aravindan; N.Sampath; M.N.Ponnuswamy; N.Kalaivasan; R.Raghunathan; M.Nethaji |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
10 |
| Pages of publication |
o1699 - o1701 |
| a |
8.422 ± 0.002 Å |
| b |
10.585 ± 0.003 Å |
| c |
12.866 ± 0.003 Å |
| α |
79.879 ± 0.004° |
| β |
76.281 ± 0.004° |
| γ |
79.042 ± 0.004° |
| Cell volume |
1083.6 ± 0.5 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0846 |
| Residual factor for significantly intense reflections |
0.0586 |
| Weighted residual factors for significantly intense reflections |
0.121 |
| Weighted residual factors for all reflections included in the refinement |
0.132 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.118 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204376.html