Information card for entry 2204476
| Chemical name |
17-butyl-16,17a-dioxo-17-aza-D-homoestra-1,3,5(10)-trien-3-yl acetate |
| Formula |
C24 H31 N O4 |
| Calculated formula |
C24 H31 N O4 |
| SMILES |
O=C1N(C(=O)[C@]2(CC[C@H]3[C@@H](CCc4cc(OC(=O)C)ccc34)[C@@H]2C1)C)CCCC |
| Title of publication |
17-Butyl-16,17a-dioxo-17-aza-<small>D</small>-homoestra-1,3,5(10)-trien-3-yl acetate |
| Authors of publication |
Hema, R.; Parthasarathi, V.; Ranju Gupta; Linden, Anthony |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
11 |
| Pages of publication |
o2002 - o2004 |
| a |
9.7793 ± 0.0004 Å |
| b |
11.3997 ± 0.0004 Å |
| c |
19.147 ± 0.0007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2134.53 ± 0.14 Å3 |
| Cell temperature |
160 ± 1 K |
| Ambient diffraction temperature |
160 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0664 |
| Residual factor for significantly intense reflections |
0.0457 |
| Weighted residual factors for significantly intense reflections |
0.11 |
| Weighted residual factors for all reflections included in the refinement |
0.1236 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.039 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204476.html