Information card for entry 2204535
| Chemical name |
2,3,4,6-Tetra-O-acetyl-β-D-glucopyranosyl azide |
| Formula |
C14 H19 N3 O9 |
| Calculated formula |
C14 H19 N3 O9 |
| SMILES |
O1[C@@H](N=N#N)[C@H](OC(=O)C)[C@@H](OC(=O)C)[C@H](OC(=O)C)[C@H]1COC(=O)C |
| Title of publication |
2,3,4,6-Tetra-<i>O</i>-acetyl-β-<small>D</small>-glucopyranosyl azide |
| Authors of publication |
Temelkoff, David P.; Norris, Peter; Zeller, Matthias |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
11 |
| Pages of publication |
o1975 - o1976 |
| a |
7.297 ± 0.0003 Å |
| b |
14.7022 ± 0.0007 Å |
| c |
15.8692 ± 0.0007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1702.48 ± 0.13 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0414 |
| Residual factor for significantly intense reflections |
0.0411 |
| Weighted residual factors for significantly intense reflections |
0.1027 |
| Weighted residual factors for all reflections included in the refinement |
0.1029 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.198 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204535.html