Information card for entry 2204650
| Chemical name |
6-Chloro-2,3,4,5-tetrahydro-7,8-dimethoxy-1-(4-methoxyphenyl)-1H-3-benzazepine |
| Formula |
C19 H22 Cl N O3 |
| Calculated formula |
C19 H22 Cl N O3 |
| SMILES |
Clc1c(OC)c(OC)cc2c1CCNCC2c1ccc(OC)cc1 |
| Title of publication |
6-Chloro-2,3,4,5-tetrahydro-7,8-dimethoxy-1-(4-methoxyphenyl)-1<i>H</i>-3-benzazepine |
| Authors of publication |
Yan, Jizhong; Cheng, Dongping |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
12 |
| Pages of publication |
o2268 - o2269 |
| a |
9.1365 ± 0.0002 Å |
| b |
9.3759 ± 0.0002 Å |
| c |
10.9936 ± 0.0003 Å |
| α |
113.675 ± 0.001° |
| β |
92.35 ± 0.001° |
| γ |
93.164 ± 0.002° |
| Cell volume |
859.11 ± 0.04 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0663 |
| Residual factor for significantly intense reflections |
0.0441 |
| Weighted residual factors for significantly intense reflections |
0.0988 |
| Weighted residual factors for all reflections included in the refinement |
0.1066 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.006 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204650.html