Information card for entry 2204726
| Chemical name |
1,3,5-Trichloro-1λ^6^,2,4,6-thiatriazin-1-one |
| Formula |
C2 Cl3 N3 O S |
| Calculated formula |
C2 Cl3 N3 O S |
| SMILES |
ClC1=NC(=NS(Cl)(=O)=N1)Cl |
| Title of publication |
1,3,5-Trichloro-1λ^6^,2,4,6-thiatriazin-1-one |
| Authors of publication |
Clark, Timothy J.; Lough, Alan J.; Chivers, Tristram; Manners, Ian |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
12 |
| Pages of publication |
o2402 - o2403 |
| a |
18.627 ± 0.0003 Å |
| b |
7.316 ± 0.0001 Å |
| c |
21.234 ± 0.0005 Å |
| α |
90° |
| β |
93.184 ± 0.0007° |
| γ |
90° |
| Cell volume |
2889.2 ± 0.09 Å3 |
| Cell temperature |
150 ± 1 K |
| Ambient diffraction temperature |
150 ± 1 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0504 |
| Residual factor for significantly intense reflections |
0.0324 |
| Weighted residual factors for significantly intense reflections |
0.0684 |
| Weighted residual factors for all reflections included in the refinement |
0.0749 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.017 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204726.html