Information card for entry 2204753
| Chemical name |
4,4'-bis[(2,2':6',2''-terpyridin-4-yl)ethynyl]-2,2'- (3,6,9-trioxaundecane-1,11-diyldioxy)-1,1'-biphenyl ethyl acetate solvate |
| Formula |
C58 H50 N6 O7 |
| Calculated formula |
C58 H50 N6 O7 |
| SMILES |
O1c2c(ccc(C#Cc3cc(nc(c3)c3ncccc3)c3ncccc3)c2)c2c(OCCOCCOCCOCC1)cc(cc2)C#Cc1cc(nc(c1)c1ncccc1)c1ncccc1.O=C(OCC)C |
| Title of publication |
A sterically constrained bis(2,2':6',2''-terpyridine) ligand |
| Authors of publication |
Benniston, Andrew C.; Clegg, William; Harrington, Ross W.; Li, Peiyi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
12 |
| Pages of publication |
o2452 - o2454 |
| a |
8.5942 ± 0.0012 Å |
| b |
42.288 ± 0.006 Å |
| c |
13.8795 ± 0.0019 Å |
| α |
90° |
| β |
101.839 ± 0.003° |
| γ |
90° |
| Cell volume |
4936.9 ± 1.2 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0596 |
| Residual factor for significantly intense reflections |
0.0514 |
| Weighted residual factors for significantly intense reflections |
0.13 |
| Weighted residual factors for all reflections included in the refinement |
0.138 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.017 |
| Diffraction radiation wavelength |
0.6948 Å |
| Diffraction radiation type |
synchrotron |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204753.html