Information card for entry 2204773
| Chemical name |
2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)hexan-2-ol |
| Formula |
C14 H17 Cl2 N3 O |
| Calculated formula |
C14 H17 Cl2 N3 O |
| SMILES |
Clc1cc(Cl)ccc1C(O)(Cn1ncnc1)CCCC |
| Title of publication |
2-(2,4-Dichlorophenyl)-1-(1<i>H</i>-1,2,4-triazol-1-yl)hexan-2-ol (hexaconazole) |
| Authors of publication |
Chopra, Deepak; Mohan, T. P.; Rao, K. S.; Guru Row, T. N. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
12 |
| Pages of publication |
o2410 - o2412 |
| a |
10.895 ± 0.006 Å |
| b |
11.006 ± 0.006 Å |
| c |
13.595 ± 0.008 Å |
| α |
90° |
| β |
106.526 ± 0.009° |
| γ |
90° |
| Cell volume |
1562.8 ± 1.5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0431 |
| Residual factor for significantly intense reflections |
0.0376 |
| Weighted residual factors for significantly intense reflections |
0.0959 |
| Weighted residual factors for all reflections included in the refinement |
0.1001 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.045 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204773.html