Information card for entry 2204805
| Chemical name |
(1R,5S,8R)-1,8-Dihydroxy-6-oxa-3-azabicyclo[3.2.1]octan-2-one |
| Formula |
C6 H9 N O4 |
| Calculated formula |
C6 H9 N O4 |
| SMILES |
[C@]12([C@@H]([C@@H](OC1)CNC2=O)O)O |
| Title of publication |
(1<i>R</i>,5<i>S</i>,8<i>R</i>)-1,8-Dihydroxy-6-oxa-3-azabicyclo[3.2.1]octan-2-one |
| Authors of publication |
Punzo, Francesco; Watkin, David J.; Iezzi Simone, Michela; Fleet, George W. J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
12 |
| Pages of publication |
o2315 - o2317 |
| a |
5.9624 ± 0.0001 Å |
| b |
10.5889 ± 0.0002 Å |
| c |
10.7089 ± 0.0002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
676.11 ± 0.02 Å3 |
| Cell temperature |
190 K |
| Ambient diffraction temperature |
190 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.028 |
| Residual factor for significantly intense reflections |
0.028 |
| Weighted residual factors for all reflections |
0.069 |
| Weighted residual factors for significantly intense reflections |
0.069 |
| Weighted residual factors for all reflections included in the refinement |
0.069 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204805.html