Information card for entry 2204821
| Chemical name |
(N-Benzoyl-N-phenylhydroxlaminato-κ^2^O,O')oxo(salicylaldehyde isonicotinoylhydrazonato-κ^3^O,N,N')vanadium(IV) hexane hemisolvate |
| Formula |
C29 H27 N4 O5 V |
| Calculated formula |
C29 H27 N4 O5 V |
| SMILES |
c12c(C=[N]3NC(c4ccncc4)=[O][V]43(O1)([O]=C(N(O4)c1ccccc1)c1ccccc1)=O)cccc2.C(CCC)CC |
| Title of publication |
(<i>N</i>-Benzoyl-<i>N</i>-phenylhydroxaminato-κ^2^<i>O,O</i>')(salicylaldehyde isonicotinoylhydrazonato-κ^3^<i>O,N,N</i>')vanadium(IV) hexane hemisolvate |
| Authors of publication |
Gao, Shan; Huo, Li-Hua; Zhao, Hui; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
12 |
| Pages of publication |
m1757 - m1758 |
| a |
10.071 ± 0.002 Å |
| b |
12.016 ± 0.002 Å |
| c |
12.966 ± 0.003 Å |
| α |
102.92 ± 0.03° |
| β |
98.52 ± 0.03° |
| γ |
113.49 ± 0.03° |
| Cell volume |
1352.3 ± 0.7 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1083 |
| Residual factor for significantly intense reflections |
0.0578 |
| Weighted residual factors for significantly intense reflections |
0.1241 |
| Weighted residual factors for all reflections included in the refinement |
0.141 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.011 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204821.html