Information card for entry 2204878
| Chemical name |
5-(N,N-Diethylamino)-4,6-diphenyl-1,2,3-triazine |
| Formula |
C19 H20 N4 |
| Calculated formula |
C19 H20 N4 |
| SMILES |
n1nnc(c(N(CC)CC)c1c1ccccc1)c1ccccc1 |
| Title of publication |
5-(<i>N</i>,<i>N</i>-Diethylamino)-4,6-diphenyl-1,2,3-triazine |
| Authors of publication |
Rozycka-Sokolowska, Ewa; Girek, Tomasz; Marciniak, Bernard; Pavlyuk, Volodymyr; Drabowicz, Jozef; Matsumoto, Kyoshi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
1 |
| Pages of publication |
o93 - o95 |
| a |
12.535 ± 0.003 Å |
| b |
7.856 ± 0.002 Å |
| c |
16.253 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1600.5 ± 0.6 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
29 |
| Hermann-Mauguin space group symbol |
P c a 21 |
| Hall space group symbol |
P 2c -2ac |
| Residual factor for all reflections |
0.0435 |
| Residual factor for significantly intense reflections |
0.0346 |
| Weighted residual factors for significantly intense reflections |
0.0861 |
| Weighted residual factors for all reflections included in the refinement |
0.0875 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.057 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204878.html