Information card for entry 2205054
| Chemical name |
N,N'-Diphenyl-2,2'-(1,3,4-thiadiazolyl-2,5-dithio)diacetamide |
| Formula |
C18 H16 N4 O2 S3 |
| Calculated formula |
C18 H16 N4 O2 S3 |
| SMILES |
S(CC(=O)Nc1ccccc1)c1sc(SCC(=O)Nc2ccccc2)nn1 |
| Title of publication |
<i>N</i>,<i>N</i>'-Diphenyl-2,2'-(1,3,4-thiadiazolyl-2,5-dithio)diacetamide |
| Authors of publication |
Yong-Hong Wen; Shu-Sheng Zhang; Bao-Hui Yu; Xue-Mei Li; Qing Liu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
2 |
| Pages of publication |
o347 - o348 |
| a |
20.6438 ± 0.0019 Å |
| b |
5.3153 ± 0.0005 Å |
| c |
16.7247 ± 0.0015 Å |
| α |
90° |
| β |
97.039 ± 0.002° |
| γ |
90° |
| Cell volume |
1821.3 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0493 |
| Residual factor for significantly intense reflections |
0.039 |
| Weighted residual factors for significantly intense reflections |
0.0951 |
| Weighted residual factors for all reflections included in the refinement |
0.1017 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205054.html