Information card for entry 2205107
| Common name |
Mercury dibromide bis-oxypyridine |
| Chemical name |
(2,2'-Bipyridine N,N'-dioxide-κ^2^O,O')dibromo-mercury(II) |
| Formula |
C10 H8 Br2 Hg N2 O2 |
| Calculated formula |
C10 H8 Br2 Hg N2 O2 |
| SMILES |
c1cc2c3ccccn3=[O][Hg]([O]=n2cc1)(Br)Br |
| Title of publication |
(2,2'-Bipyridine <i>N</i>,<i>N</i>'-dioxide-κ^2^<i>O</i>,<i>O</i>')dibromomercury(II) |
| Authors of publication |
Tedmann, Onyango M.; Zavalij, Peter Y.; Madan, Stanley K.; Oliver, Scott R.J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
2 |
| Pages of publication |
m212 - m213 |
| a |
9.826 ± 0.003 Å |
| b |
8.235 ± 0.002 Å |
| c |
16.073 ± 0.005 Å |
| α |
90° |
| β |
95.857 ± 0.005° |
| γ |
90° |
| Cell volume |
1293.8 ± 0.6 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0669 |
| Residual factor for significantly intense reflections |
0.0418 |
| Weighted residual factors for significantly intense reflections |
0.0991 |
| Weighted residual factors for all reflections included in the refinement |
0.1128 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205107.html