Information card for entry 2205391
| Chemical name |
2,2'-Diamino-4,4'-bi-1,3-thiazolium (2R,3R)-tartrate |
| Formula |
C10 H12 N4 O6 S2 |
| Calculated formula |
C10 H12 N4 O6 S2 |
| SMILES |
s1c([nH+]c(c1)c1[nH+]c(sc1)N)N.[O-]C(=O)[C@H](O)[C@@H](O)C(=O)[O-] |
| Title of publication |
2,2'-Diamino-4,4'-bi-1,3-thiazolium (2<i>R</i>,3<i>R</i>)-tartrate |
| Authors of publication |
Liu, Bing-Xin; Xu, Duan-Jun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
3 |
| Pages of publication |
o753 - o755 |
| a |
11.0122 ± 0.0007 Å |
| b |
11.0122 ± 0.0007 Å |
| c |
18.8285 ± 0.0014 Å |
| α |
90° |
| β |
90° |
| γ |
120° |
| Cell volume |
1977.4 ± 0.2 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
154 |
| Hermann-Mauguin space group symbol |
P 32 2 1 |
| Hall space group symbol |
P 32 2" |
| Residual factor for all reflections |
0.032 |
| Residual factor for significantly intense reflections |
0.03 |
| Weighted residual factors for significantly intense reflections |
0.075 |
| Weighted residual factors for all reflections included in the refinement |
0.076 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.06 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205391.html