Information card for entry 2205445
| Common name |
metaldehyde |
| Chemical name |
2,4,6,8-tetramethyl-1,3,5,7-tetroxocane |
| Formula |
C8 H16 O4 |
| Calculated formula |
C8 H16 O4 |
| SMILES |
C[C@@H]1O[C@H](C)O[C@@H](O[C@@H](O1)C)C |
| Title of publication |
A low-temperature redetermination of metaldehyde |
| Authors of publication |
Barnett, Sarah A.; Hulme, Ashley T.; Tocher, Derek A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
4 |
| Pages of publication |
o857 - o859 |
| a |
10.4974 ± 0.001 Å |
| b |
10.4974 ± 0.001 Å |
| c |
4.0967 ± 0.0007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
451.44 ± 0.1 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
79 |
| Hermann-Mauguin space group symbol |
I 4 |
| Hall space group symbol |
I 4 |
| Residual factor for all reflections |
0.0289 |
| Residual factor for significantly intense reflections |
0.0288 |
| Weighted residual factors for significantly intense reflections |
0.0732 |
| Weighted residual factors for all reflections included in the refinement |
0.0732 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.079 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205445.html