Information card for entry 2205699
| Chemical name |
4-(4,5,6,7-tetrachloro-1,3-dioxoisoindolin-2-yl)benzaldehyde |
| Formula |
C15 H5 Cl4 N O3 |
| Calculated formula |
C15 H5 Cl4 N O3 |
| SMILES |
Clc1c2C(=O)N(C(=O)c2c(Cl)c(Cl)c1Cl)c1ccc(cc1)C=O |
| Title of publication |
4-(4,5,6,7-Tetrachloro-1,3-dioxoisoindolin-2-yl)benzaldehyde |
| Authors of publication |
Liu, Xin-Gang; Feng, Ya-Qing; Wang, Wei; Liang, Zu-Pei; Yang, Guang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
5 |
| Pages of publication |
o1316 - o1317 |
| a |
12.6686 ± 0.001 Å |
| b |
8.9057 ± 0.0007 Å |
| c |
13.44 ± 0.0011 Å |
| α |
90° |
| β |
91.737 ± 0.001° |
| γ |
90° |
| Cell volume |
1515.6 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0382 |
| Residual factor for significantly intense reflections |
0.0301 |
| Weighted residual factors for all reflections included in the refinement |
0.0852 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.098 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205699.html