Information card for entry 2205728
| Chemical name |
6-Cyano-3,3-dimethyl-5-methylsulfanyl-1,3-dihydro-2-oxo-1-thia- 3b,4,8-triazaindacene 1,1-dioxide |
| Formula |
C11 H10 N4 O3 S2 |
| Calculated formula |
C11 H10 N4 O3 S2 |
| SMILES |
S1(=O)(=O)OC(C)(C)c2nc3n(nc(SC)c3C#N)cc12 |
| Title of publication |
6-Cyano-3,3-dimethyl-5-methylsulfanyl-1,3-dihydro-2-oxo-1-thia-3b,4,8-triazaindacene 1,1-dioxide |
| Authors of publication |
Tian, Li; Wang, Da-Xiang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
5 |
| Pages of publication |
o1286 - o1287 |
| a |
7.15 ± 0.002 Å |
| b |
8.573 ± 0.003 Å |
| c |
11.171 ± 0.003 Å |
| α |
98.316 ± 0.004° |
| β |
98.953 ± 0.004° |
| γ |
98.42 ± 0.004° |
| Cell volume |
659.2 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0447 |
| Residual factor for significantly intense reflections |
0.0393 |
| Weighted residual factors for significantly intense reflections |
0.1184 |
| Weighted residual factors for all reflections included in the refinement |
0.1208 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.077 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205728.html