Information card for entry 2205782
| Chemical name |
diethyl cis-1,2,3,4,5,10-hexahydro-7,8-dimethyl-1,4-dioxo-2,3,4a,10a- tetraazabenzo[g]cyclopent[cd]azulene-2a,10b-dicarboxylate chloroform disolvate |
| Formula |
C22 H26 Cl6 N4 O6 |
| Calculated formula |
C22 H26 Cl6 N4 O6 |
| SMILES |
Cc1cc2c(cc1C)CN1C3(C(C(=O)OCC)(NC(=O)N3C2)NC1=O)C(=O)OCC.C(Cl)(Cl)Cl.C(Cl)(Cl)Cl |
| Title of publication |
Diethyl <i>cis</i>-1,2,3,4,5,10-hexahydro-7,8-dimethyl-1,4-dioxo-2,3,4a,10a-tetraazabenzo[<i>g</i>]cyclopent[<i>cd</i>]azulene-2a,10b-dicarboxylate chloroform disolvate |
| Authors of publication |
Wei, Fa-Qian; Wu, An-Xin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
5 |
| Pages of publication |
o1453 - o1455 |
| a |
25.216 ± 0.003 Å |
| b |
9.9757 ± 0.0009 Å |
| c |
25.566 ± 0.003 Å |
| α |
90° |
| β |
108.566 ± 0.003° |
| γ |
90° |
| Cell volume |
6096.4 ± 1.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0947 |
| Residual factor for significantly intense reflections |
0.0582 |
| Weighted residual factors for significantly intense reflections |
0.1126 |
| Weighted residual factors for all reflections included in the refinement |
0.1192 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.022 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205782.html