Information card for entry 2205886
| Chemical name |
(2R,3R,4R)-Methyl 2-bromo-3,4-dihydroxy-3,4-O-isopropylidenetetrahydrofuran- 2-carboxylate |
| Formula |
C9 H13 Br O5 |
| Calculated formula |
C9 H13 Br O5 |
| SMILES |
Br[C@@]1(OC[C@@H]2[C@H]1OC(O2)(C)C)C(=O)OC |
| Title of publication |
(2<i>R</i>,3<i>R</i>,4<i>R</i>)-Methyl 2-bromo-3,4-dihydroxy-3,4-<i>O</i>-isopropylidenetetrahydrofuran-2-carboxylate |
| Authors of publication |
Probert, Michael R.; Watkin, David J.; Stewart, Alistair J.; Storer, Richard; Fleet, George W. J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
6 |
| Pages of publication |
o1718 - o1720 |
| a |
6.6195 ± 0.0002 Å |
| b |
10.4127 ± 0.0003 Å |
| c |
16.3294 ± 0.0007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1125.53 ± 0.07 Å3 |
| Cell temperature |
190 K |
| Ambient diffraction temperature |
190 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0501 |
| Residual factor for significantly intense reflections |
0.0501 |
| Weighted residual factors for all reflections |
0.097 |
| Weighted residual factors for significantly intense reflections |
0.097 |
| Weighted residual factors for all reflections included in the refinement |
0.097 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.9731 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205886.html