Information card for entry 2206029
| Common name |
(4aS*,7aR*)-2,10-Dioxoperhydrobenzo[d]naphthalene |
| Chemical name |
(4aS*,7aR*)-2,10(3H,11H)-Dioxooctahydro-1H-benzo[d]naphthalene |
| Formula |
C14 H20 O2 |
| Calculated formula |
C14 H20 O2 |
| SMILES |
O=C1CC23[C@H](CC1)CCC[C@@H]2CCC(=O)C3.O=C1CC23[C@@H](CC1)CCC[C@H]2CCC(=O)C3 |
| Title of publication |
(4a<i>S</i>*,7a<i>R</i>*)-2,10-Dioxoperhydrobenzo[<i>d</i>]naphthalene |
| Authors of publication |
Thompson, Hugh W.; Lalancette, Roger A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
6 |
| Pages of publication |
o1614 - o1616 |
| a |
10.618 ± 0.003 Å |
| b |
16.224 ± 0.004 Å |
| c |
6.9661 ± 0.0015 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1200 ± 0.5 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.09 |
| Residual factor for significantly intense reflections |
0.045 |
| Weighted residual factors for significantly intense reflections |
0.074 |
| Weighted residual factors for all reflections included in the refinement |
0.086 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.01 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206029.html