Information card for entry 2206033
| Chemical name |
2,9-Dichloroquino[2,3-b]acridine-7,14(5H,12H)-dithione dimethylformamide disolvate |
| Formula |
C26 H24 Cl2 N4 O2 S2 |
| Calculated formula |
C26 H24 Cl2 N4 O2 S2 |
| SMILES |
c1c(Cl)ccc2c1C(=S)c1c(N2)cc2C(=S)c3cc(ccc3Nc2c1)Cl.O=CN(C)C.N(C=O)(C)C |
| Title of publication |
2,9-Dichloroquino[2,3-<i>b</i>]acridine-7,14(5<i>H</i>,12<i>H</i>)-dithione dimethylformamide disolvate |
| Authors of publication |
Senju, Takatoshi; Hoki, Tomonori; Mizuguchi, Jin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
6 |
| Pages of publication |
o1617 - o1619 |
| a |
33.257 ± 0.004 Å |
| b |
4.2682 ± 0.0006 Å |
| c |
21.589 ± 0.003 Å |
| α |
90° |
| β |
123.872 ± 0.007° |
| γ |
90° |
| Cell volume |
2544.4 ± 0.6 Å3 |
| Cell temperature |
93.1 K |
| Number of distinct elements |
6 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for significantly intense reflections |
0.034 |
| Weighted residual factors for all reflections included in the refinement |
0.096 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.098 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206033.html