Information card for entry 2206534
| Chemical name |
4,5-Dimethoxycyclopent-4-ene-1,2,3-trione |
| Formula |
C7 H6 O5 |
| Calculated formula |
C7 H6 O5 |
| SMILES |
O(C1=C(OC)C(=O)C(=O)C1=O)C |
| Title of publication |
4,5-Dimethoxycyclopent-4-ene-1,2,3-trione |
| Authors of publication |
Chen, Hong-Yu; Fang, Qi; Xue, Gang; Yu, Wen-Tao |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
8 |
| Pages of publication |
o2696 - o2698 |
| a |
7.181 ± 0.005 Å |
| b |
8.069 ± 0.005 Å |
| c |
13.015 ± 0.005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
754.1 ± 0.8 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0883 |
| Residual factor for significantly intense reflections |
0.0404 |
| Weighted residual factors for significantly intense reflections |
0.0905 |
| Weighted residual factors for all reflections included in the refinement |
0.1171 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.944 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206534.html