Information card for entry 2206675
| Chemical name |
Aqua(2,2'-bipyridine-κ^2^N,N')(L-malato-κ^3^O,O',O'')copper(II) |
| Formula |
C14 H14 Cu N2 O6 |
| Calculated formula |
C14 H14 Cu N2 O6 |
| SMILES |
[Cu]123(OC(=O)[C@@H]([OH]1)CC(=O)O2)([OH2])[n]1ccccc1c1[n]3cccc1 |
| Title of publication |
Aqua(2,2'-bipyridine-κ^2^<i>N</i>,<i>N</i>')(<small>L</small>-malato-κ^3^<i>O</i>,<i>O</i>',<i>O</i>'')copper(II) |
| Authors of publication |
He, Long |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
9 |
| Pages of publication |
m1752 - m1754 |
| a |
10.4874 ± 0.0006 Å |
| b |
6.5998 ± 0.0003 Å |
| c |
10.7986 ± 0.0004 Å |
| α |
90° |
| β |
106.57 ± 0.002° |
| γ |
90° |
| Cell volume |
716.38 ± 0.06 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0296 |
| Residual factor for significantly intense reflections |
0.0277 |
| Weighted residual factors for significantly intense reflections |
0.069 |
| Weighted residual factors for all reflections included in the refinement |
0.0698 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.113 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206675.html