Information card for entry 2206721
| Chemical name |
N-(3-Chlorophenyl)-2-{[(1E)-(4-methylphenyl)methylene]amino}-4,5,6,7- tetrahydro-1-benzothiophene-3-carboxamide |
| Formula |
C23 H21 Cl N2 O S |
| Calculated formula |
C23 H21 Cl N2 O S |
| SMILES |
Clc1cc(NC(=O)c2c(sc3CCCCc23)/N=C/c2ccc(cc2)C)ccc1 |
| Title of publication |
<i>N</i>-(3-Chlorophenyl)-2-{[(1<i>E</i>)-(4-methylphenyl)methylene]amino}-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| Authors of publication |
Anilkumar, G. N.; Kokila, M. K.; Puttaraja; Mohan, S.; Majunath Shetty, K. S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
9 |
| Pages of publication |
o2841 - o2843 |
| a |
7.828 ± 0.003 Å |
| b |
19.652 ± 0.006 Å |
| c |
13.086 ± 0.004 Å |
| α |
90° |
| β |
98.854 ± 0.005° |
| γ |
90° |
| Cell volume |
1989.1 ± 1.1 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.056 |
| Residual factor for significantly intense reflections |
0.0467 |
| Weighted residual factors for significantly intense reflections |
0.1182 |
| Weighted residual factors for all reflections included in the refinement |
0.124 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.094 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206721.html