Information card for entry 2206724
| Chemical name |
3,3,4,4,5,5-Hexafluoro-1,2-bis(2-ethyl-5-formyl-3-thienyl)cyclopent-1-ene |
| Formula |
C19 H14 F6 O2 S2 |
| Calculated formula |
C19 H14 F6 O2 S2 |
| SMILES |
s1c(c(C2=C(C(F)(F)C(F)(F)C2(F)F)c2c(sc(c2)C=O)CC)cc1C=O)CC |
| Title of publication |
1,2-Bis(2-ethyl-5-formyl-3-thienyl)-3,3,4,4,5,5-hexafluorocyclopent-1-ene |
| Authors of publication |
Pu, Shou-Zhi; Yang, Tian-She; Yan, Liu-Shui |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
9 |
| Pages of publication |
o2961 - o2963 |
| a |
11.2889 ± 0.0011 Å |
| b |
13.4306 ± 0.0013 Å |
| c |
13.4236 ± 0.0012 Å |
| α |
90° |
| β |
96.816 ± 0.007° |
| γ |
90° |
| Cell volume |
2020.9 ± 0.3 Å3 |
| Cell temperature |
295 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1109 |
| Residual factor for significantly intense reflections |
0.069 |
| Weighted residual factors for significantly intense reflections |
0.1243 |
| Weighted residual factors for all reflections included in the refinement |
0.1413 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.04 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206724.html