Information card for entry 2206834
| Chemical name |
Aqua(2,2'-diamino-4,4'-bi-1,3-thiazole-κ^2^N,N')(thiodiacetato- κ^3^O,S,O')cobalt(II) dihydrate |
| Formula |
C10 H16 Co N4 O7 S3 |
| Calculated formula |
C10 H16 Co N4 O7 S3 |
| SMILES |
[Co]123(OC(=O)C[S]3CC(=O)O1)([OH2])[n]1c(N)scc1c1[n]2c(N)sc1.O.O |
| Title of publication |
Aqua(2,2'-diamino-4,4'-bi-1,3-thiazole-κ^2^<i>N</i>,<i>N</i>')(thiodiacetato-κ^3^<i>O</i>,<i>S</i>,<i>O</i>')cobalt(II) dihydrate |
| Authors of publication |
Bing-Xin Liu; Jian-Yong Yu; Duan-Jun Xu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
10 |
| Pages of publication |
m1978 - m1980 |
| a |
10.6918 ± 0.0011 Å |
| b |
7.1329 ± 0.0007 Å |
| c |
22.794 ± 0.002 Å |
| α |
90° |
| β |
102.538 ± 0.002° |
| γ |
90° |
| Cell volume |
1696.9 ± 0.3 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.052 |
| Residual factor for significantly intense reflections |
0.042 |
| Weighted residual factors for significantly intense reflections |
0.097 |
| Weighted residual factors for all reflections included in the refinement |
0.102 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206834.html