Information card for entry 2206852
| Chemical name |
4,4,5,5-Tetramethyl-2-thiazol-2-ylimidazolidine-1,3-diol |
| Formula |
C10 H17 N3 O2 S |
| Calculated formula |
C10 H17 N3 O2 S |
| SMILES |
s1ccnc1C1N(O)C(C(N1O)(C)C)(C)C |
| Title of publication |
4,4,5,5-Tetramethyl-2-(thiazol-2-yl)imidazolidine-1,3-diol |
| Authors of publication |
Jiang, Kai; Chang, Jiu-Li; Wang, Li-Ya; Ma, Lu-Fang; Wang, Yu-Fang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
10 |
| Pages of publication |
o3430 - o3432 |
| a |
6.9785 ± 0.0005 Å |
| b |
18.7982 ± 0.0013 Å |
| c |
10.0764 ± 0.0007 Å |
| α |
90° |
| β |
107.367 ± 0.001° |
| γ |
90° |
| Cell volume |
1261.59 ± 0.15 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0636 |
| Residual factor for significantly intense reflections |
0.0525 |
| Weighted residual factors for significantly intense reflections |
0.1387 |
| Weighted residual factors for all reflections included in the refinement |
0.1483 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.06 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206852.html