Information card for entry 2206993
| Chemical name |
4-(Benzenesulfonyloxy)-2,2,6,6-tetramethylpiperidin-4-yl oxide |
| Formula |
C15 H22 N O4 S |
| Calculated formula |
C15 H22 N O4 S |
| SMILES |
c1ccccc1S(=O)(=O)OC1CC(C)(C)[N](C(C)(C)C1)=O |
| Title of publication |
4-(Benzenesulfonyloxy)-2,2,6,6-tetramethylpiperidin-4-yl oxide |
| Authors of publication |
Zhou, Bao-Han; Meng, Xiang-Gao; Yin, Guo-Dong; Wu, An-Xin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
10 |
| Pages of publication |
o3377 - o3379 |
| a |
11.4827 ± 0.0009 Å |
| b |
15.6864 ± 0.0013 Å |
| c |
18.4671 ± 0.0014 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3326.3 ± 0.5 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0683 |
| Residual factor for significantly intense reflections |
0.0467 |
| Weighted residual factors for significantly intense reflections |
0.1303 |
| Weighted residual factors for all reflections included in the refinement |
0.1455 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.061 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206993.html