Information card for entry 2207016
| Chemical name |
5,11,17,23-Tetranitro-25,26,27,28-tetrapentyloxycalix[4]arene |
| Formula |
C48 H60 N4 O12 |
| Calculated formula |
C48 H60 N4 O12 |
| SMILES |
C1c2c(c(Cc3c(c(cc(c3)N(=O)=O)Cc3c(c(Cc4c(c1cc(c4)N(=O)=O)OCCCCC)cc(c3)N(=O)=O)OCCCCC)OCCCCC)cc(c2)N(=O)=O)OCCCCC |
| Title of publication |
5,11,17,23-Tetranitro-25,26,27,28-tetrapentyloxycalix[4]arene |
| Authors of publication |
Vysotsky, Myroslav O.; Böhmer, Volker; Bru Roig, Miriam; Bolte, Michael |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
10 |
| Pages of publication |
o3526 - o3528 |
| a |
22.5587 ± 0.0011 Å |
| b |
11.8751 ± 0.0004 Å |
| c |
19.2336 ± 0.0011 Å |
| α |
90° |
| β |
112.057 ± 0.004° |
| γ |
90° |
| Cell volume |
4775.3 ± 0.4 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0948 |
| Residual factor for significantly intense reflections |
0.0824 |
| Weighted residual factors for significantly intense reflections |
0.236 |
| Weighted residual factors for all reflections included in the refinement |
0.2472 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.068 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2207016.html